CAS 112893-26-2 is the registry number for Becliconazole. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 100mg, 25mg, 10mg, 50mg, Get quote.
1-[(5-chloro-1-benzofuran-2-yl)-(2-chlorophenyl)methyl]imidazole (CAS 112893-26-2) is a chemical compound with the molecular formula C18H12Cl2N2O and a molecular weight of 343.2 g/mol. IUPAC name: 1-[(5-chloro-1-benzofuran-2-yl)-(2-chlorophenyl)methyl]imidazole. InChIKey: ZSTBJMFRJPALNV-UHFFFAOYSA-N.
| Molecular formula | C18H12Cl2N2O |
|---|---|
| Molecular weight | 343.2 g/mol |
| IUPAC name | 1-[(5-chloro-1-benzofuran-2-yl)-(2-chlorophenyl)methyl]imidazole |
| InChIKey | ZSTBJMFRJPALNV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C2=CC3=C(O2)C=CC(=C3)Cl)N4C=CN=C4)Cl |
Computed by PubChem (NCBI)