CAS 112923-64-5 appears in our catalog under these names: (+)–Osbeckic acid, (+)-Osbeckic acid. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 1 mg, 5 mg.
5-[(S)-carboxy(hydroxy)methyl]furan-2-carboxylic acid (CAS 112923-64-5) is a chemical compound with the molecular formula C7H6O6 and a molecular weight of 186.12 g/mol. IUPAC name: 5-[(S)-carboxy(hydroxy)methyl]furan-2-carboxylic acid. InChIKey: UAFTYLJFMASQBP-YFKPBYRVSA-N.
| Molecular formula | C7H6O6 |
|---|---|
| Molecular weight | 186.12 g/mol |
| IUPAC name | 5-[(S)-carboxy(hydroxy)methyl]furan-2-carboxylic acid |
| InChIKey | UAFTYLJFMASQBP-YFKPBYRVSA-N |
| SMILES | C1=C(OC(=C1)C(=O)O)[C@@H](C(=O)O)O |
Computed by PubChem (NCBI)