Products 1129406-54-7
CAS 1129406-54-7 is the registry number for Urease-IN-7. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(3-bromophenyl)-6-(4-fluorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine (CAS 1129406-54-7) is a chemical compound with the molecular formula C16H10BrFN4S and a molecular weight of 389.2 g/mol. IUPAC name: 3-(3-bromophenyl)-6-(4-fluorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine. InChIKey: JPIJDAUPQCSQTO-UHFFFAOYSA-N.
| Molecular formula | C16H10BrFN4S |
|---|---|
| Molecular weight | 389.2 g/mol |
| IUPAC name | 3-(3-bromophenyl)-6-(4-fluorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| InChIKey | JPIJDAUPQCSQTO-UHFFFAOYSA-N |
| SMILES | C1C(=NN2C(=NN=C2S1)C3=CC(=CC=C3)Br)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)