Products 112965-15-8
CAS 112965-15-8 is the registry number for L 668411. Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
Methyl (2E,4E)-11-[(2R,3R)-3-(hydroxymethyl)-4-oxooxetan-2-yl]-3,5,7-trimethylundeca-2,4-dienoate (CAS 112965-15-8) is a chemical compound with the molecular formula C19H30O5 and a molecular weight of 338.4 g/mol. IUPAC name: methyl (2E,4E)-11-[(2R,3R)-3-(hydroxymethyl)-4-oxooxetan-2-yl]-3,5,7-trimethylundeca-2,4-dienoate. InChIKey: MMICHQCZQPCQGB-RWPMBREYSA-N.
| Molecular formula | C19H30O5 |
|---|---|
| Molecular weight | 338.4 g/mol |
| IUPAC name | methyl (2E,4E)-11-[(2R,3R)-3-(hydroxymethyl)-4-oxooxetan-2-yl]-3,5,7-trimethylundeca-2,4-dienoate |
| InChIKey | MMICHQCZQPCQGB-RWPMBREYSA-N |
| SMILES | CC(CCCC[C@@H]1[C@H](C(=O)O1)CO)C/C(=C/C(=C/C(=O)OC)/C)/C |
Computed by PubChem (NCBI)