CAS 1189907-75-2 appears in our catalog under these names: Idebenone-13C,d3, >95% (HPLC), Idebenone-13C,d3, Idebenone-13C,d3, 99.62%. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 1 mg.
2-(10-hydroxydecyl)-6-methoxy-3-methyl-5-(trideuterio(113C)methoxy)cyclohexa-2,5-diene-1,4-dione (CAS 1189907-75-2) is a chemical compound with the molecular formula C19H30O5 and a molecular weight of 342.4 g/mol. IUPAC name: 2-(10-hydroxydecyl)-6-methoxy-3-methyl-5-(trideuterio(113C)methoxy)cyclohexa-2,5-diene-1,4-dione. InChIKey: JGPMMRGNQUBGND-JVXUGDAPSA-N.
| Molecular formula | C19H30O5 |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | 2-(10-hydroxydecyl)-6-methoxy-3-methyl-5-(trideuterio(113C)methoxy)cyclohexa-2,5-diene-1,4-dione |
| InChIKey | JGPMMRGNQUBGND-JVXUGDAPSA-N |
| SMILES | [2H][13C]([2H])([2H])OC1=C(C(=O)C(=C(C1=O)C)CCCCCCCCCCO)OC |
Computed by PubChem (NCBI)