Products 1129725-67-2
CAS 1129725-67-2 is the registry number for 2-epi-Fagomine. Offered by: TRC. Available pack sizes: 50mg.
(2S,3R,4R)-2-(hydroxymethyl)piperidine-3,4-diol (CAS 1129725-67-2) is a chemical compound with the molecular formula C6H13NO3 and a molecular weight of 147.17 g/mol. IUPAC name: (2S,3R,4R)-2-(hydroxymethyl)piperidine-3,4-diol. InChIKey: YZNNBIPIQWYLDM-KVQBGUIXSA-N.
| Molecular formula | C6H13NO3 |
|---|---|
| Molecular weight | 147.17 g/mol |
| IUPAC name | (2S,3R,4R)-2-(hydroxymethyl)piperidine-3,4-diol |
| InChIKey | YZNNBIPIQWYLDM-KVQBGUIXSA-N |
| SMILES | C1CN[C@H]([C@H]([C@@H]1O)O)CO |
Computed by PubChem (NCBI)