CAS 113046-72-3 is the registry number for Ethyl 6,7-difluoro-1-methyl-4-oxo-4h-[1,3]thiazeto[3,2-a]quinoline-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 10g, 5g.
Ethyl 6,7-difluoro-1-methyl-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylate (CAS 113046-72-3) is a chemical compound with the molecular formula C14H11F2NO3S and a molecular weight of 311.31 g/mol. IUPAC name: ethyl 6,7-difluoro-1-methyl-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylate. InChIKey: UUJUEXKIHKGFTH-UHFFFAOYSA-N.
| Molecular formula | C14H11F2NO3S |
|---|---|
| Molecular weight | 311.31 g/mol |
| IUPAC name | ethyl 6,7-difluoro-1-methyl-4-oxo-1H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylate |
| InChIKey | UUJUEXKIHKGFTH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2N(C(S2)C)C3=CC(=C(C=C3C1=O)F)F |
Computed by PubChem (NCBI)