CAS 1130899-41-0 appears in our catalog under these names: Ibandronic Acid-d3, Ibandronate-d3, Ibandronic Acid-d3, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg, 2.5 mg.
[1-hydroxy-3-[pentyl(trideuteriomethyl)amino]-1-phosphonopropyl]phosphonic acid (CAS 1130899-41-0) is a chemical compound with the molecular formula C9H23NO7P2 and a molecular weight of 322.25 g/mol. IUPAC name: [1-hydroxy-3-[pentyl(trideuteriomethyl)amino]-1-phosphonopropyl]phosphonic acid. InChIKey: MPBVHIBUJCELCL-BMSJAHLVSA-N.
| Molecular formula | C9H23NO7P2 |
|---|---|
| Molecular weight | 322.25 g/mol |
| IUPAC name | [1-hydroxy-3-[pentyl(trideuteriomethyl)amino]-1-phosphonopropyl]phosphonic acid |
| InChIKey | MPBVHIBUJCELCL-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])N(CCCCC)CCC(O)(P(=O)(O)O)P(=O)(O)O |
Computed by PubChem (NCBI)