CAS 1131-01-7 appears in our catalog under these names: Lidocaine EP Impurity H, Lidocaine Impurity H(EP), 2-Chloro-2,6-dimethylacetanilide, >95% (HPLC), 2-Chloro-2',6'-dimethylacetanilide, >95% (HPLC), 2-Chloro-N-(2,6-dimethylphenyl)acetamide. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: on request, 10g, 1g, 5g, 4x25mg, 25mg, 100mg, 100g.
2-chloro-N-(2,6-dimethylphenyl)acetamide (CAS 1131-01-7) is a chemical compound with the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. IUPAC name: 2-chloro-N-(2,6-dimethylphenyl)acetamide. InChIKey: FPQQSNUTBWFFLB-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | 2-chloro-N-(2,6-dimethylphenyl)acetamide |
| InChIKey | FPQQSNUTBWFFLB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)CCl |
Computed by PubChem (NCBI)