CAS 1131335-54-0 is the registry number for 2,3-Dimethoxy-6-(trimethylsilyl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(5,6-dimethoxy-2-pyridinyl)-trimethylsilane (CAS 1131335-54-0) is a chemical compound with the molecular formula C10H17NO2Si and a molecular weight of 211.33 g/mol. IUPAC name: (5,6-dimethoxy-2-pyridinyl)-trimethylsilane. InChIKey: YEWXSCYFBZMKQZ-UHFFFAOYSA-N.
| Molecular formula | C10H17NO2Si |
|---|---|
| Molecular weight | 211.33 g/mol |
| IUPAC name | (5,6-dimethoxy-2-pyridinyl)-trimethylsilane |
| InChIKey | YEWXSCYFBZMKQZ-UHFFFAOYSA-N |
| SMILES | COC1=C(N=C(C=C1)[Si](C)(C)C)OC |
Computed by PubChem (NCBI)