Products 1131576-06-1
CAS 1131576-06-1 appears in our catalog under these names: Tramiprosate–d6, Homotaurine-d6, >95% (HPLC), 3-Aminopropane-d6-sulfonic Acid, 98 atom % D, min 98% Chemical Purity, Tramiprosate-d6, 98.0%. Offered by: GLPBio, TRC, CDN, MedChemExpress. Available pack sizes: 1mg, 50mg, 5mg, 0,1g, 0,05g, 10mg, 10 mg, 5 mg.
3-amino-1,1,2,2,3,3-hexadeuteriopropane-1-sulfonic acid (CAS 1131576-06-1) is a chemical compound with the molecular formula C3H9NO3S and a molecular weight of 145.21 g/mol. IUPAC name: 3-amino-1,1,2,2,3,3-hexadeuteriopropane-1-sulfonic acid. InChIKey: SNKZJIOFVMKAOJ-NMFSSPJFSA-N.
| Molecular formula | C3H9NO3S |
|---|---|
| Molecular weight | 145.21 g/mol |
| IUPAC name | 3-amino-1,1,2,2,3,3-hexadeuteriopropane-1-sulfonic acid |
| InChIKey | SNKZJIOFVMKAOJ-NMFSSPJFSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])N)C([2H])([2H])S(=O)(=O)O |
Computed by PubChem (NCBI)