CAS 1131992-26-1 is the registry number for 6-Bromo-2,4-dichloro-7-(phenylsulfonyl)-7h-pyrrolo[2,3-d]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
7-(benzenesulfonyl)-6-bromo-2,4-dichloropyrrolo[2,3-d]pyrimidine (CAS 1131992-26-1) is a chemical compound with the molecular formula C12H6BrCl2N3O2S and a molecular weight of 407.1 g/mol. IUPAC name: 7-(benzenesulfonyl)-6-bromo-2,4-dichloropyrrolo[2,3-d]pyrimidine. InChIKey: MIFZKYAZWMEXLC-UHFFFAOYSA-N.
| Molecular formula | C12H6BrCl2N3O2S |
|---|---|
| Molecular weight | 407.1 g/mol |
| IUPAC name | 7-(benzenesulfonyl)-6-bromo-2,4-dichloropyrrolo[2,3-d]pyrimidine |
| InChIKey | MIFZKYAZWMEXLC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C(=CC3=C2N=C(N=C3Cl)Cl)Br |
Computed by PubChem (NCBI)