CAS 1132-39-4 appears in our catalog under these names: Diphenyl selenide, 95%, Diphenylselenide, Diphenyl selenide, 97% , DIPHENYL SELENIDE, 96%, Diphenyl selenide, 97%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Sigma-Aldrich, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g, 2g.
Phenylselanylbenzene (CAS 1132-39-4) is a chemical compound with the molecular formula C12H10Se and a molecular weight of 233.18 g/mol. IUPAC name: phenylselanylbenzene. InChIKey: ORQWTLCYLDRDHK-UHFFFAOYSA-N.
| Molecular formula | C12H10Se |
|---|---|
| Molecular weight | 233.18 g/mol |
| IUPAC name | phenylselanylbenzene |
| InChIKey | ORQWTLCYLDRDHK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[Se]C2=CC=CC=C2 |
Computed by PubChem (NCBI)