CAS 113214-30-5 appears in our catalog under these names: 5–Methyl–4–Phenyl–2–(2–thienyl)–thiazole, 5-Methyl-4-phenyl-2-(2-thienyl)thiazole, 95%, 95%, WAY-639729, 95.0%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1g, 250mg, 50mg, 100mg, 10 mg.
5-methyl-4-phenyl-2-thiophen-2-yl-1,3-thiazole (CAS 113214-30-5) is a chemical compound with the molecular formula C14H11NS2 and a molecular weight of 257.4 g/mol. IUPAC name: 5-methyl-4-phenyl-2-thiophen-2-yl-1,3-thiazole. InChIKey: GJCUAOPBECGQBG-UHFFFAOYSA-N.
| Molecular formula | C14H11NS2 |
|---|---|
| Molecular weight | 257.4 g/mol |
| IUPAC name | 5-methyl-4-phenyl-2-thiophen-2-yl-1,3-thiazole |
| InChIKey | GJCUAOPBECGQBG-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)C2=CC=CS2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)