CAS 113247-16-8 is the registry number for Methyl 1-(4-chlorophenyl)-9H-pyrido(3,4-b)indole-3-carboxylate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g.
Methyl 1-(4-chlorophenyl)-9H-pyrido[3,4-b]indole-3-carboxylate (CAS 113247-16-8) is a chemical compound with the molecular formula C19H13ClN2O2 and a molecular weight of 336.8 g/mol. IUPAC name: methyl 1-(4-chlorophenyl)-9H-pyrido[3,4-b]indole-3-carboxylate. InChIKey: DTWOZTKIUZICRR-UHFFFAOYSA-N.
| Molecular formula | C19H13ClN2O2 |
|---|---|
| Molecular weight | 336.8 g/mol |
| IUPAC name | methyl 1-(4-chlorophenyl)-9H-pyrido[3,4-b]indole-3-carboxylate |
| InChIKey | DTWOZTKIUZICRR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC(=C2C(=C1)C3=CC=CC=C3N2)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)