CAS 113283-03-7 appears in our catalog under these names: (2-Bromophenyl)methanesulfonamide, 98%, 2-Bromobenzylsulfonamide, 95+%, 2–Bromobenzylsulfonamide, 2-Bromobenzylsulfonamide. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 10g, 250mg, 1g, 5g, 100mg.
(2-bromophenyl)methanesulfonamide (CAS 113283-03-7) is a chemical compound with the molecular formula C7H8BrNO2S and a molecular weight of 250.12 g/mol. IUPAC name: (2-bromophenyl)methanesulfonamide. InChIKey: XOHYLTHDHSCAIA-UHFFFAOYSA-N.
| Molecular formula | C7H8BrNO2S |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | (2-bromophenyl)methanesulfonamide |
| InChIKey | XOHYLTHDHSCAIA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CS(=O)(=O)N)Br |
Computed by PubChem (NCBI)