Products 1133115-54-4
CAS 1133115-54-4 is the registry number for Methyl 2-amino-4-(4-fluorophenyl)pyrimidine-5-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-amino-4-(4-fluorophenyl)pyrimidine-5-carboxylate (CAS 1133115-54-4) is a chemical compound with the molecular formula C12H10FN3O2 and a molecular weight of 247.22 g/mol. IUPAC name: methyl 2-amino-4-(4-fluorophenyl)pyrimidine-5-carboxylate. InChIKey: OLAPAXBLTBUSJJ-UHFFFAOYSA-N.
| Molecular formula | C12H10FN3O2 |
|---|---|
| Molecular weight | 247.22 g/mol |
| IUPAC name | methyl 2-amino-4-(4-fluorophenyl)pyrimidine-5-carboxylate |
| InChIKey | OLAPAXBLTBUSJJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=C(N=C1C2=CC=C(C=C2)F)N |
Computed by PubChem (NCBI)