Products 1133115-60-2
CAS 1133115-60-2 is the registry number for Methyl 5-bromo-4-chloro-8-methylquinoline-2-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
Methyl 5-bromo-4-chloro-8-methylquinoline-2-carboxylate (CAS 1133115-60-2) is a chemical compound with the molecular formula C12H9BrClNO2 and a molecular weight of 314.56 g/mol. IUPAC name: methyl 5-bromo-4-chloro-8-methylquinoline-2-carboxylate. InChIKey: GDNKVLCQALRHCP-UHFFFAOYSA-N.
| Molecular formula | C12H9BrClNO2 |
|---|---|
| Molecular weight | 314.56 g/mol |
| IUPAC name | methyl 5-bromo-4-chloro-8-methylquinoline-2-carboxylate |
| InChIKey | GDNKVLCQALRHCP-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)Br)C(=CC(=N2)C(=O)OC)Cl |
Computed by PubChem (NCBI)