CAS 1133116-05-8 appears in our catalog under these names: 2-(3-Bromo-4-(trifluoromethoxy)phenyl)-2,2-difluoroacetic acid, 95%, 2-(3-Bromo-4-(trifluoromethoxy)phenyl)-2,2-difluoroacetic acid. Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 5g.
2-[3-bromo-4-(trifluoromethoxy)phenyl]-2,2-difluoroacetic acid (CAS 1133116-05-8) is a chemical compound with the molecular formula C9H4BrF5O3 and a molecular weight of 335.02 g/mol. IUPAC name: 2-[3-bromo-4-(trifluoromethoxy)phenyl]-2,2-difluoroacetic acid. InChIKey: XMWNWBBKIPEOIQ-UHFFFAOYSA-N.
| Molecular formula | C9H4BrF5O3 |
|---|---|
| Molecular weight | 335.02 g/mol |
| IUPAC name | 2-[3-bromo-4-(trifluoromethoxy)phenyl]-2,2-difluoroacetic acid |
| InChIKey | XMWNWBBKIPEOIQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(C(=O)O)(F)F)Br)OC(F)(F)F |
Computed by PubChem (NCBI)