CAS 1133123-01-9 is the registry number for 4-Bromo-2,3-difluorobenzenesulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-2,3-difluorobenzenesulfonamide (CAS 1133123-01-9) is a chemical compound with the molecular formula C6H4BrF2NO2S and a molecular weight of 272.07 g/mol. IUPAC name: 4-bromo-2,3-difluorobenzenesulfonamide. InChIKey: SSEAJHBQTBTYMI-UHFFFAOYSA-N.
| Molecular formula | C6H4BrF2NO2S |
|---|---|
| Molecular weight | 272.07 g/mol |
| IUPAC name | 4-bromo-2,3-difluorobenzenesulfonamide |
| InChIKey | SSEAJHBQTBTYMI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1S(=O)(=O)N)F)F)Br |
Computed by PubChem (NCBI)