CAS 1133425-75-8 appears in our catalog under these names: Deferasirox-d4, Deferasirox-d4, >95% (HPLC), Deferasirox–d4. Offered by: Chemat Brand, Hubei YoungXin, TRC, TargetMol, GLPBio. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
4-[3,5-bis(2-hydroxyphenyl)-1,2,4-triazol-1-yl]-2,3,5,6-tetradeuteriobenzoic acid (CAS 1133425-75-8) is a chemical compound with the molecular formula C21H15N3O4 and a molecular weight of 377.4 g/mol. IUPAC name: 4-[3,5-bis(2-hydroxyphenyl)-1,2,4-triazol-1-yl]-2,3,5,6-tetradeuteriobenzoic acid. InChIKey: BOFQWVMAQOTZIW-IRYCTXJYSA-N.
| Molecular formula | C21H15N3O4 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | 4-[3,5-bis(2-hydroxyphenyl)-1,2,4-triazol-1-yl]-2,3,5,6-tetradeuteriobenzoic acid |
| InChIKey | BOFQWVMAQOTZIW-IRYCTXJYSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)O)[2H])[2H])N2C(=NC(=N2)C3=CC=CC=C3O)C4=CC=CC=C4O)[2H] |
Computed by PubChem (NCBI)