CAS 1133819-87-0 appears in our catalog under these names: Msdc 0602, 95%, MSDC 0602, Azemiglitazone, MSDC-0602, Azemiglitazone 98+%. Offered by: Combi-blocks, TRC, TargetMol, Biosynth, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 10mg, 25mg, 50mg, 5mg, 200mg.
5-[[4-[2-(3-methoxyphenyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (CAS 1133819-87-0) is a chemical compound with the molecular formula C19H17NO5S and a molecular weight of 371.4 g/mol. IUPAC name: 5-[[4-[2-(3-methoxyphenyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione. InChIKey: YAUMOGALQJYOJQ-UHFFFAOYSA-N.
| Molecular formula | C19H17NO5S |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | 5-[[4-[2-(3-methoxyphenyl)-2-oxoethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| InChIKey | YAUMOGALQJYOJQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C(=O)COC2=CC=C(C=C2)CC3C(=O)NC(=O)S3 |
Computed by PubChem (NCBI)