CAS 1133843-97-6 appears in our catalog under these names: Terephthalaldehyde-tetra(4-aminophenyl)methane copolymer, 95%, Terephthalaldehyde-tetra(4-aminophenyl)methane copolymer, 95%,RG, 95%,RG. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg.
Terephthalaldehyde;4-[tris(4-aminophenyl)methyl]aniline (CAS 1133843-97-6) is a chemical compound with the molecular formula C33H30N4O2 and a molecular weight of 514.6 g/mol. IUPAC name: terephthalaldehyde;4-[tris(4-aminophenyl)methyl]aniline. InChIKey: WJNCCEFPQVRKJQ-UHFFFAOYSA-N.
| Molecular formula | C33H30N4O2 |
|---|---|
| Molecular weight | 514.6 g/mol |
| IUPAC name | terephthalaldehyde;4-[tris(4-aminophenyl)methyl]aniline |
| InChIKey | WJNCCEFPQVRKJQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C=O.C1=CC(=CC=C1C(C2=CC=C(C=C2)N)(C3=CC=C(C=C3)N)C4=CC=C(C=C4)N)N |
Computed by PubChem (NCBI)