CAS 1134-04-9 is the registry number for 2,3,4,5-Tetrachloro-6-(trichloromethyl)pyridine, 97%. Offered by: AmBeed. Available pack sizes: 250mg.
2,3,4,5-tetrachloro-6-(trichloromethyl)pyridine (CAS 1134-04-9) is a chemical compound with the molecular formula C6Cl7N and a molecular weight of 334.2 g/mol. IUPAC name: 2,3,4,5-tetrachloro-6-(trichloromethyl)pyridine. InChIKey: YMBFWRZKTZICHS-UHFFFAOYSA-N.
| Molecular formula | C6Cl7N |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | 2,3,4,5-tetrachloro-6-(trichloromethyl)pyridine |
| InChIKey | YMBFWRZKTZICHS-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=NC(=C1Cl)Cl)C(Cl)(Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)