CAS 1134334-68-1 is the registry number for 2-Iodo-1-(5-methoxy-1,2-dimethyl-1H-indol-3-yl)-ethanone. Offered by: Biosynth. Available pack sizes: 5000mg.
2-iodo-1-(5-methoxy-1,2-dimethylindol-3-yl)ethanone (CAS 1134334-68-1) is a chemical compound with the molecular formula C13H14INO2 and a molecular weight of 343.16 g/mol. IUPAC name: 2-iodo-1-(5-methoxy-1,2-dimethylindol-3-yl)ethanone. InChIKey: IWDPQQZCTAJEGR-UHFFFAOYSA-N.
| Molecular formula | C13H14INO2 |
|---|---|
| Molecular weight | 343.16 g/mol |
| IUPAC name | 2-iodo-1-(5-methoxy-1,2-dimethylindol-3-yl)ethanone |
| InChIKey | IWDPQQZCTAJEGR-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1C)C=CC(=C2)OC)C(=O)CI |
Computed by PubChem (NCBI)