Products 1134516-21-4
CAS 1134516-21-4 is the registry number for 2-Bromo-1-(3,5-dimethylpiperidin-1-yl)-3-methylbutan-1-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-bromo-1-(3,5-dimethylpiperidin-1-yl)-3-methylbutan-1-one (CAS 1134516-21-4) is a chemical compound with the molecular formula C12H22BrNO and a molecular weight of 276.21 g/mol. IUPAC name: 2-bromo-1-(3,5-dimethylpiperidin-1-yl)-3-methylbutan-1-one. InChIKey: NSMZGWTYMABJNA-UHFFFAOYSA-N.
| Molecular formula | C12H22BrNO |
|---|---|
| Molecular weight | 276.21 g/mol |
| IUPAC name | 2-bromo-1-(3,5-dimethylpiperidin-1-yl)-3-methylbutan-1-one |
| InChIKey | NSMZGWTYMABJNA-UHFFFAOYSA-N |
| SMILES | CC1CC(CN(C1)C(=O)C(C(C)C)Br)C |
Computed by PubChem (NCBI)