CAS 1134789-63-1 is the registry number for 2,4,6-Tris(5-bromothiophen-2-yl)-1,3,5-triazine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2,4,6-tris(5-bromothiophen-2-yl)-1,3,5-triazine (CAS 1134789-63-1) is a chemical compound with the molecular formula C15H6Br3N3S3 and a molecular weight of 564.1 g/mol. IUPAC name: 2,4,6-tris(5-bromothiophen-2-yl)-1,3,5-triazine. InChIKey: QEXBMVULXVQGBK-UHFFFAOYSA-N.
| Molecular formula | C15H6Br3N3S3 |
|---|---|
| Molecular weight | 564.1 g/mol |
| IUPAC name | 2,4,6-tris(5-bromothiophen-2-yl)-1,3,5-triazine |
| InChIKey | QEXBMVULXVQGBK-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)Br)C2=NC(=NC(=N2)C3=CC=C(S3)Br)C4=CC=C(S4)Br |
Computed by PubChem (NCBI)