Products 1134822-07-3
CAS 1134822-07-3 appears in our catalog under these names: Ivacaftor hydrate, Ivacaftor hydrate, Ivacaftor (hydrate). Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, 5mg, Get quote.
N-(2,4-ditert-butyl-5-hydroxyphenyl)-4-oxo-1H-quinoline-3-carboxamide;hydrate (CAS 1134822-07-3) is a chemical compound with the molecular formula C24H30N2O4 and a molecular weight of 410.5 g/mol. IUPAC name: N-(2,4-ditert-butyl-5-hydroxyphenyl)-4-oxo-1H-quinoline-3-carboxamide;hydrate. InChIKey: MYELKYHBCRDZNH-UHFFFAOYSA-N.
| Molecular formula | C24H30N2O4 |
|---|---|
| Molecular weight | 410.5 g/mol |
| IUPAC name | N-(2,4-ditert-butyl-5-hydroxyphenyl)-4-oxo-1H-quinoline-3-carboxamide;hydrate |
| InChIKey | MYELKYHBCRDZNH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1NC(=O)C2=CNC3=CC=CC=C3C2=O)O)C(C)(C)C.O |
Computed by PubChem (NCBI)