CAS 1134950-89-2 appears in our catalog under these names: 3,5-Dibromo-4-hydroxybenzylamine hydrochloride, 95%, 3,5-Dibromo-4-hydroxybenzylamine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g, 2g.
4-(aminomethyl)-2,6-dibromophenol;hydrochloride (CAS 1134950-89-2) is a chemical compound with the molecular formula C7H8Br2ClNO and a molecular weight of 317.40 g/mol. IUPAC name: 4-(aminomethyl)-2,6-dibromophenol;hydrochloride. InChIKey: XETWXRDQBCVAEV-UHFFFAOYSA-N.
| Molecular formula | C7H8Br2ClNO |
|---|---|
| Molecular weight | 317.40 g/mol |
| IUPAC name | 4-(aminomethyl)-2,6-dibromophenol;hydrochloride |
| InChIKey | XETWXRDQBCVAEV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)O)Br)CN.Cl |
Computed by PubChem (NCBI)