CAS 1135000-36-0 appears in our catalog under these names: ELOVL6–IN–5, ELOVL6-IN-5, 95.12%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 5 mg, 50 mg, 25 mg, 100 mg, 10 mg.
3-pyridin-2-ylsulfonyl-N-[4-(trifluoromethyl)phenyl]-8-azabicyclo[3.2.1]octane-8-carboxamide (CAS 1135000-36-0) is a chemical compound with the molecular formula C20H20F3N3O3S and a molecular weight of 439.5 g/mol. IUPAC name: 3-pyridin-2-ylsulfonyl-N-[4-(trifluoromethyl)phenyl]-8-azabicyclo[3.2.1]octane-8-carboxamide. InChIKey: WYCGDOXAJCYGEC-UHFFFAOYSA-N.
| Molecular formula | C20H20F3N3O3S |
|---|---|
| Molecular weight | 439.5 g/mol |
| IUPAC name | 3-pyridin-2-ylsulfonyl-N-[4-(trifluoromethyl)phenyl]-8-azabicyclo[3.2.1]octane-8-carboxamide |
| InChIKey | WYCGDOXAJCYGEC-UHFFFAOYSA-N |
| SMILES | C1CC2CC(CC1N2C(=O)NC3=CC=C(C=C3)C(F)(F)F)S(=O)(=O)C4=CC=CC=N4 |
Computed by PubChem (NCBI)