CAS 1135008-81-9 is the registry number for CRBN ligand-200. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(7-bromo-2-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione (CAS 1135008-81-9) is a chemical compound with the molecular formula C14H12BrN3O3 and a molecular weight of 350.17 g/mol. IUPAC name: 3-(7-bromo-2-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione. InChIKey: KMVPTGAJQSRRMY-UHFFFAOYSA-N.
| Molecular formula | C14H12BrN3O3 |
|---|---|
| Molecular weight | 350.17 g/mol |
| IUPAC name | 3-(7-bromo-2-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione |
| InChIKey | KMVPTGAJQSRRMY-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=CC(=C2)Br)C(=O)N1C3CCC(=O)NC3=O |
Computed by PubChem (NCBI)