CAS 1135023-73-2 is the registry number for 3-(5-Carboxy-2,4-dimethoxyphenyl)-1-phenyl-1H-pyrazole-4-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-(5-carboxy-2,4-dimethoxyphenyl)-1-phenylpyrazole-4-carboxylic acid (CAS 1135023-73-2) is a chemical compound with the molecular formula C19H16N2O6 and a molecular weight of 368.3 g/mol. IUPAC name: 3-(5-carboxy-2,4-dimethoxyphenyl)-1-phenylpyrazole-4-carboxylic acid. InChIKey: XIZNFYWLTJHHCV-UHFFFAOYSA-N.
| Molecular formula | C19H16N2O6 |
|---|---|
| Molecular weight | 368.3 g/mol |
| IUPAC name | 3-(5-carboxy-2,4-dimethoxyphenyl)-1-phenylpyrazole-4-carboxylic acid |
| InChIKey | XIZNFYWLTJHHCV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C2=NN(C=C2C(=O)O)C3=CC=CC=C3)C(=O)O)OC |
Computed by PubChem (NCBI)