Products 1135051-02-3

CAS 1135051-02-3 is the registry number for Hexahydro-1,​4,​5-​thiadiazepine 1,​1-​dioxide hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1,4,5-thiadiazepane 1,1-dioxide;hydrochloride (CAS 1135051-02-3) is a chemical compound with the molecular formula C4H11ClN2O2S and a molecular weight of 186.66 g/mol. IUPAC name: 1,4,5-thiadiazepane 1,1-dioxide;hydrochloride. InChIKey: UUBHITWTNYMJEE-UHFFFAOYSA-N.

Identity
Molecular formulaC4H11ClN2O2S
Molecular weight186.66 g/mol
IUPAC name1,4,5-thiadiazepane 1,1-dioxide;hydrochloride
InChIKeyUUBHITWTNYMJEE-UHFFFAOYSA-N
SMILESC1CS(=O)(=O)CCNN1.Cl

Computed by PubChem (NCBI)