CAS 113507-82-7 appears in our catalog under these names: Perfluoro(2-ethoxyethane) sulfonic acid, Perfluoro(2-ethoxyethane) sulfonic acid 50 µg/mL in Methanol:Water, Perfluoro(2–ethoxyethane)sulfonic Acid, Perfluoro-3-oxapentane-sulfonic acid, 1,1,2,2-Tetrafluoro-2-(1,1,2,2,2-pentafl. Offered by: Dr. Ehrenstorfer, GLPBio, Biosynth, Sigma-Aldrich, HPC Standards. Available pack sizes: 100mg, 1ml, 1g, 250mg, 500mg, 2g, 5g, 25MG.
1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonic acid (CAS 113507-82-7) is a chemical compound with the molecular formula C4HF9O4S and a molecular weight of 316.10 g/mol. IUPAC name: 1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonic acid. InChIKey: RJGUAQKOHAABLK-UHFFFAOYSA-N.
| Molecular formula | C4HF9O4S |
|---|---|
| Molecular weight | 316.10 g/mol |
| IUPAC name | 1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethanesulfonic acid |
| InChIKey | RJGUAQKOHAABLK-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)(OC(C(F)(F)S(=O)(=O)O)(F)F)(F)F |
Computed by PubChem (NCBI)