CAS 1135099-88-5 is the registry number for 4,5-Dibromo-N-(1-methyl-1H-pyrazol-3-yl)thiophene-2-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4,5-dibromo-N-(1-methylpyrazol-3-yl)thiophene-2-carboxamide (CAS 1135099-88-5) is a chemical compound with the molecular formula C9H7Br2N3OS and a molecular weight of 365.05 g/mol. IUPAC name: 4,5-dibromo-N-(1-methylpyrazol-3-yl)thiophene-2-carboxamide. InChIKey: UVPJVULDDSTRBX-UHFFFAOYSA-N.
| Molecular formula | C9H7Br2N3OS |
|---|---|
| Molecular weight | 365.05 g/mol |
| IUPAC name | 4,5-dibromo-N-(1-methylpyrazol-3-yl)thiophene-2-carboxamide |
| InChIKey | UVPJVULDDSTRBX-UHFFFAOYSA-N |
| SMILES | CN1C=CC(=N1)NC(=O)C2=CC(=C(S2)Br)Br |
Computed by PubChem (NCBI)