CAS 113520-22-2 is the registry number for 2-Piperazin-1-yl[1,3]oxazolo[4,5-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-piperazin-1-yl-[1,3]oxazolo[4,5-b]pyridine (CAS 113520-22-2) is a chemical compound with the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. IUPAC name: 2-piperazin-1-yl-[1,3]oxazolo[4,5-b]pyridine. InChIKey: GSHPHBYVQTWDMY-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O |
|---|---|
| Molecular weight | 204.23 g/mol |
| IUPAC name | 2-piperazin-1-yl-[1,3]oxazolo[4,5-b]pyridine |
| InChIKey | GSHPHBYVQTWDMY-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC3=C(O2)C=CC=N3 |
Computed by PubChem (NCBI)