Products 113520-44-8
CAS 113520-44-8 appears in our catalog under these names: H-4-Me-Leu-OMe, 97%, (S)-Methyl 2-amino-4,4-dimethylpentanoate, 97%. Offered by: Ambeed, BLDpharm, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
Methyl (2S)-2-amino-4,4-dimethylpentanoate (CAS 113520-44-8) is a chemical compound with the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. IUPAC name: methyl (2S)-2-amino-4,4-dimethylpentanoate. InChIKey: AHLUWXPHJXOHIQ-LURJTMIESA-N.
| Molecular formula | C8H17NO2 |
|---|---|
| Molecular weight | 159.23 g/mol |
| IUPAC name | methyl (2S)-2-amino-4,4-dimethylpentanoate |
| InChIKey | AHLUWXPHJXOHIQ-LURJTMIESA-N |
| SMILES | CC(C)(C)C[C@@H](C(=O)OC)N |
Computed by PubChem (NCBI)
Synonyms:
(S)-Methyl 2-amino-4,4-dimethylpentanoate, methyl (2S)-2-amino-4,4-dimethylpentanoate, H-4-Me-Leu-OMe, Methyl (2S)-2-amino-4,4-dimethyl-pentanoate, 4-Methyl-L-leucine Methyl Ester, AHLUWXPHJXOHIQ-LURJTMIESA-N, gamma-methyl-L-Leucine methyl ester, (S)-Methyl2-amino-4,4-dimethylpentanoate, methyl (S)-2-amino-4,4-dimethylpentanoate