Products 1135283-83-8
CAS 1135283-83-8 is the registry number for 5-Trifluoromethyl-benzo[b]thiophene-2-carbaldehyde, 95%. Offered by: Fluorochem. Available pack sizes: 1g.
5-(trifluoromethyl)-1-benzothiophene-2-carbaldehyde (CAS 1135283-83-8) is a chemical compound with the molecular formula C10H5F3OS and a molecular weight of 230.21 g/mol. IUPAC name: 5-(trifluoromethyl)-1-benzothiophene-2-carbaldehyde. InChIKey: DTIDFIVAOCVTND-UHFFFAOYSA-N.
| Molecular formula | C10H5F3OS |
|---|---|
| Molecular weight | 230.21 g/mol |
| IUPAC name | 5-(trifluoromethyl)-1-benzothiophene-2-carbaldehyde |
| InChIKey | DTIDFIVAOCVTND-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)C=C(S2)C=O |
Computed by PubChem (NCBI)