CAS 113534-16-0 appears in our catalog under these names: Fmoc-Asn(Dod)-OH, Fmoc–Asn(Dod)–OH. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 25g, 10g.
(2S)-4-[bis(4-methoxyphenyl)methylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid (CAS 113534-16-0) is a chemical compound with the molecular formula C34H32N2O7 and a molecular weight of 580.6 g/mol. IUPAC name: (2S)-4-[bis(4-methoxyphenyl)methylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid. InChIKey: NUINEVHFMAGARJ-PMERELPUSA-N.
| Molecular formula | C34H32N2O7 |
|---|---|
| Molecular weight | 580.6 g/mol |
| IUPAC name | (2S)-4-[bis(4-methoxyphenyl)methylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid |
| InChIKey | NUINEVHFMAGARJ-PMERELPUSA-N |
| SMILES | COC1=CC=C(C=C1)C(C2=CC=C(C=C2)OC)NC(=O)C[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)