Products 1135366-22-1
CAS 1135366-22-1 is the registry number for (2R)-2-Hydroxy-4-((4-methoxyphenyl)methoxy)-N,N,N-trimethyl-4-oxo-1-butanaminium Chloride. Offered by: TRC. Available pack sizes: 100mg, 1g, 2,5g.
[(2R)-2-hydroxy-4-[(4-methoxyphenyl)methoxy]-4-oxobutyl]-trimethylazanium chloride (CAS 1135366-22-1) is a chemical compound with the molecular formula C15H24ClNO4 and a molecular weight of 317.81 g/mol. IUPAC name: [(2R)-2-hydroxy-4-[(4-methoxyphenyl)methoxy]-4-oxobutyl]-trimethylazanium chloride. InChIKey: SWLXZPOOSRXHSJ-BTQNPOSSSA-M.
| Molecular formula | C15H24ClNO4 |
|---|---|
| Molecular weight | 317.81 g/mol |
| IUPAC name | [(2R)-2-hydroxy-4-[(4-methoxyphenyl)methoxy]-4-oxobutyl]-trimethylazanium chloride |
| InChIKey | SWLXZPOOSRXHSJ-BTQNPOSSSA-M |
| SMILES | C[N+](C)(C)C[C@@H](CC(=O)OCC1=CC=C(C=C1)OC)O.[Cl-] |
Computed by PubChem (NCBI)