CAS 1135871-83-8 appears in our catalog under these names: (3-Oxo-2,3-dihydro-1h-inden-5-yl)boronic acid, 95%, (3-Oxo-2,3-dihydro-1H-inden-5-yl)boronic acid, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 5g, 250mg, 1g, 100mg.
(3-oxo-1,2-dihydroinden-5-yl)boronic acid (CAS 1135871-83-8) is a chemical compound with the molecular formula C9H9BO3 and a molecular weight of 175.98 g/mol. IUPAC name: (3-oxo-1,2-dihydroinden-5-yl)boronic acid. InChIKey: ANQOFXCMJAXRJH-UHFFFAOYSA-N.
| Molecular formula | C9H9BO3 |
|---|---|
| Molecular weight | 175.98 g/mol |
| IUPAC name | (3-oxo-1,2-dihydroinden-5-yl)boronic acid |
| InChIKey | ANQOFXCMJAXRJH-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(CCC2=O)C=C1)(O)O |
Computed by PubChem (NCBI)