Products 1135916-92-5

CAS 1135916-92-5 appears in our catalog under these names: 2-Amino-2-(4-chloro-3-fluorophenyl)acetic acid hydrochloride, 95%, 2-Amino-2-(4-chloro-3-fluorophenyl)acetic acid hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 10g.

Structural formula: {0} (CAS {1})

2-amino-2-(4-chloro-3-fluorophenyl)acetic acid;hydrochloride (CAS 1135916-92-5) is a chemical compound with the molecular formula C8H8Cl2FNO2 and a molecular weight of 240.06 g/mol. IUPAC name: 2-amino-2-(4-chloro-3-fluorophenyl)acetic acid;hydrochloride. InChIKey: OCAODCXJDZSULF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8Cl2FNO2
Molecular weight240.06 g/mol
IUPAC name2-amino-2-(4-chloro-3-fluorophenyl)acetic acid;hydrochloride
InChIKeyOCAODCXJDZSULF-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(C(=O)O)N)F)Cl.Cl

Computed by PubChem (NCBI)