CAS 113601-46-0 is the registry number for 3-Bromo-2,4,5,6-tetrafluorobenzotrifluoride, 95%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 10g, 5g, 1g, on request.
1-bromo-2,3,4,6-tetrafluoro-5-(trifluoromethyl)benzene (CAS 113601-46-0) is a chemical compound with the molecular formula C7BrF7 and a molecular weight of 296.97 g/mol. IUPAC name: 1-bromo-2,3,4,6-tetrafluoro-5-(trifluoromethyl)benzene. InChIKey: NHSSJMAUKULEMJ-UHFFFAOYSA-N.
| Molecular formula | C7BrF7 |
|---|---|
| Molecular weight | 296.97 g/mol |
| IUPAC name | 1-bromo-2,3,4,6-tetrafluoro-5-(trifluoromethyl)benzene |
| InChIKey | NHSSJMAUKULEMJ-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1F)Br)F)F)F)C(F)(F)F |
Computed by PubChem (NCBI)