CAS 1136010-98-4 is the registry number for 4-((R)-(4-Chlorophenyl)phenylmethyl)-1-piperazinecarboxaldehyde, >95% (HPLC). Offered by: TRC. Available pack sizes: 50mg.
4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazine-1-carbaldehyde (CAS 1136010-98-4) is a chemical compound with the molecular formula C18H19ClN2O and a molecular weight of 314.8 g/mol. IUPAC name: 4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazine-1-carbaldehyde. InChIKey: LGLPBHBLXSWKFD-GOSISDBHSA-N.
| Molecular formula | C18H19ClN2O |
|---|---|
| Molecular weight | 314.8 g/mol |
| IUPAC name | 4-[(R)-(4-chlorophenyl)-phenylmethyl]piperazine-1-carbaldehyde |
| InChIKey | LGLPBHBLXSWKFD-GOSISDBHSA-N |
| SMILES | C1CN(CCN1C=O)[C@H](C2=CC=CC=C2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)