Products 113626-86-1
CAS 113626-86-1 is the registry number for Carboprost Impurity 16. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-3-methyloct-1-enyl]cyclopentyl]hept-5-enoate (CAS 113626-86-1) is a chemical compound with the molecular formula C22H38O5 and a molecular weight of 382.5 g/mol. IUPAC name: methyl (E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-3-methyloct-1-enyl]cyclopentyl]hept-5-enoate. InChIKey: QQCOAAFKJZXJFP-UDNOTHBBSA-N.
| Molecular formula | C22H38O5 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | methyl (E)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-3-methyloct-1-enyl]cyclopentyl]hept-5-enoate |
| InChIKey | QQCOAAFKJZXJFP-UDNOTHBBSA-N |
| SMILES | CCCCC[C@](C)(/C=C/[C@H]1[C@@H](C[C@@H]([C@@H]1C/C=C/CCCC(=O)OC)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Carboprost Impurity 16