CAS 1137279-00-5 is the registry number for 4–(5–chloro–2–(methylthio)thiazolo(4,5–d)pyrimidin–7–yl)morpholine. Offered by: GLPBio. Available pack sizes: 200mg.
4-(5-chloro-2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)morpholine (CAS 1137279-00-5) is a chemical compound with the molecular formula C10H11ClN4OS2 and a molecular weight of 302.8 g/mol. IUPAC name: 4-(5-chloro-2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)morpholine. InChIKey: QGPQRCRYLBUXJI-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN4OS2 |
|---|---|
| Molecular weight | 302.8 g/mol |
| IUPAC name | 4-(5-chloro-2-methylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)morpholine |
| InChIKey | QGPQRCRYLBUXJI-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(S1)C(=NC(=N2)Cl)N3CCOCC3 |
Computed by PubChem (NCBI)