CAS 113759-19-6 is the registry number for SM-8849. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[1-(3-fluoro-4-phenylphenyl)ethyl]-N-methyl-1,3-thiazol-2-amine (CAS 113759-19-6) is a chemical compound with the molecular formula C18H17FN2S and a molecular weight of 312.4 g/mol. IUPAC name: 4-[1-(3-fluoro-4-phenylphenyl)ethyl]-N-methyl-1,3-thiazol-2-amine. InChIKey: ZTFDMDJGJVUYQE-UHFFFAOYSA-N.
| Molecular formula | C18H17FN2S |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 4-[1-(3-fluoro-4-phenylphenyl)ethyl]-N-methyl-1,3-thiazol-2-amine |
| InChIKey | ZTFDMDJGJVUYQE-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)C2=CC=CC=C2)F)C3=CSC(=N3)NC |
Computed by PubChem (NCBI)