CAS 1137725-46-2 appears in our catalog under these names: 4-Cyano-4-[(ethylsulfanylthiocarbonyl)sulfanyl]pentanoic acid, 95%, 4-Cyano-4-((ethylsulfanylthiocarbonyl)sulfanyl)pentanoic Acid, 4–Cyano–4–(((ethylthio)carbonothioyl)thio)pentanoic acid, 4-Cyano-4-[[(ethylthio)thioxomethyl]thio]pentanoic Acid, >95.0%(HPLC)(T), 4-Cyano-4-(((ethylthio)carbonothioyl)thio)pentanoic acid, 97%, 97%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g, 100mg, 10mg, 50mg, 250mg, 10g.
4-cyano-4-ethylsulfanylcarbothioylsulfanylpentanoic acid (CAS 1137725-46-2) is a chemical compound with the molecular formula C9H13NO2S3 and a molecular weight of 263.4 g/mol. IUPAC name: 4-cyano-4-ethylsulfanylcarbothioylsulfanylpentanoic acid. InChIKey: KEWSCDNULKOKTG-UHFFFAOYSA-N.
| Molecular formula | C9H13NO2S3 |
|---|---|
| Molecular weight | 263.4 g/mol |
| IUPAC name | 4-cyano-4-ethylsulfanylcarbothioylsulfanylpentanoic acid |
| InChIKey | KEWSCDNULKOKTG-UHFFFAOYSA-N |
| SMILES | CCSC(=S)SC(C)(CCC(=O)O)C#N |
Computed by PubChem (NCBI)