CAS 113794-48-2 appears in our catalog under these names: 3-(tert-Butyldimethylsilyloxy)glutaric Acid, 95+%, 3-(tert-Butyldimethylsilyloxy)glutaric Acid 95+%, 3-(tert-Butyldimethylsilyloxy)glutaric Acid, 95+%, 95+%. Offered by: Chemat Brand, Ambeed, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
3-[tert-butyl(dimethyl)silyl]oxypentanedioic acid (CAS 113794-48-2) is a chemical compound with the molecular formula C11H22O5Si and a molecular weight of 262.37 g/mol. IUPAC name: 3-[tert-butyl(dimethyl)silyl]oxypentanedioic acid. InChIKey: OHPIOMMEWYTXCL-UHFFFAOYSA-N.
| Molecular formula | C11H22O5Si |
|---|---|
| Molecular weight | 262.37 g/mol |
| IUPAC name | 3-[tert-butyl(dimethyl)silyl]oxypentanedioic acid |
| InChIKey | OHPIOMMEWYTXCL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC(CC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)