CAS 1137967-28-2 appears in our catalog under these names: (Z)-FeCP-Oxindole, (Z)-FeCP-oxindole/ 100%, (Z)–FeCP–oxindole, (Z)-FeCP-oxindole, 99.62%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 25mg, 1mg, 5mg, 10mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso).
Cyclopenta-1,3-diene;3-(cyclopenta-2,4-dien-1-ylidenemethyl)-1H-indol-2-olate;iron(2+) (CAS 1137967-28-2) is a chemical compound with the molecular formula C19H15FeNO and a molecular weight of 329.2 g/mol. IUPAC name: cyclopenta-1,3-diene;3-(cyclopenta-2,4-dien-1-ylidenemethyl)-1H-indol-2-olate;iron(2+). InChIKey: MTGBTDOTYGXLBK-UHFFFAOYSA-M.
| Molecular formula | C19H15FeNO |
|---|---|
| Molecular weight | 329.2 g/mol |
| IUPAC name | cyclopenta-1,3-diene;3-(cyclopenta-2,4-dien-1-ylidenemethyl)-1H-indol-2-olate;iron(2+) |
| InChIKey | MTGBTDOTYGXLBK-UHFFFAOYSA-M |
| SMILES | [CH-]1C=CC=C1.C1=CC=C2C(=C1)C(=C(N2)[O-])C=C3C=CC=C3.[Fe+2] |
Computed by PubChem (NCBI)